C18H17N3O6 — CID 108518223
dimethyl 2-[[2-oxo-2-(pyridin-4-ylmethylamino)acetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 108518223) has the molecular formula C18H17N3O6 and a molecular weight of 371.35 g/mol. Its IUPAC name is dimethyl 2-[[2-oxo-2-(pyridin-4-ylmethylamino)acetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-oxo-2-(pyridin-4-ylmethylamino)acetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108518223 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | dimethyl 2-[[2-oxo-2-(pyridin-4-ylmethylamino)acetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)C(=O)NCc2ccncc2)c1 |
| InChI | InChI=1S/C18H17N3O6/c1-26-17(24)12-3-4-13(18(25)27-2)14(9-12)21-16(23)15(22)20-10-11-5-7-19-8-6-11/h3-9H,10H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | VJIYTPNVQDSZTM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|