C16H19N3O7 — CID 108524431
dimethyl 2-[[2-(3-formamidopropylamino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 108524431) has the molecular formula C16H19N3O7 and a molecular weight of 365.34 g/mol. Its IUPAC name is dimethyl 2-[[2-(3-formamidopropylamino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-(3-formamidopropylamino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108524431 |
| Molecular Formula | C16H19N3O7 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | dimethyl 2-[[2-(3-formamidopropylamino)-2-oxoacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)C(=O)NCCCNC=O)c1 |
| InChI | InChI=1S/C16H19N3O7/c1-25-15(23)10-4-5-11(16(24)26-2)12(8-10)19-14(22)13(21)18-7-3-6-17-9-20/h4-5,8-9H,3,6-7H2,1-2H3,(H,17,20)(H,18,21)(H,19,22) |
| InChIKey | PYMWMMHOCNNBAX-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|