C16H18N2O6 — CID 108521058
dimethyl 2-[(2-oxo-2-pyrrolidin-1-ylacetyl)amino]benzene-1,4-dicarboxylate (PubChem CID 108521058) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is dimethyl 2-[(2-oxo-2-pyrrolidin-1-ylacetyl)amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(2-oxo-2-pyrrolidin-1-ylacetyl)amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108521058 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | dimethyl 2-[(2-oxo-2-pyrrolidin-1-ylacetyl)amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C16H18N2O6/c1-23-15(21)10-5-6-11(16(22)24-2)12(9-10)17-13(19)14(20)18-7-3-4-8-18/h5-6,9H,3-4,7-8H2,1-2H3,(H,17,19) |
| InChIKey | LKDCZPPZNHWKQB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|