C17H22N4O6 — CID 108524502
dimethyl 2-[[2-[(4-methylpiperazin-1-yl)amino]-2-oxoacetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 108524502) has the molecular formula C17H22N4O6 and a molecular weight of 378.39 g/mol. Its IUPAC name is dimethyl 2-[[2-[(4-methylpiperazin-1-yl)amino]-2-oxoacetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-[(4-methylpiperazin-1-yl)amino]-2-oxoacetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108524502 |
| Molecular Formula | C17H22N4O6 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | dimethyl 2-[[2-[(4-methylpiperazin-1-yl)amino]-2-oxoacetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)C(=O)NN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C17H22N4O6/c1-20-6-8-21(9-7-20)19-15(23)14(22)18-13-10-11(16(24)26-2)4-5-12(13)17(25)27-3/h4-5,10H,6-9H2,1-3H3,(H,18,22)(H,19,23) |
| InChIKey | ZRNKICQWDQHPMV-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|