C20H29NO5 — CID 4183842
dimethyl 2-(decanoylamino)benzene-1,4-dicarboxylate (PubChem CID 4183842) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is dimethyl 2-(decanoylamino)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(decanoylamino)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 4183842 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | dimethyl 2-(decanoylamino)benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCCCC(=O)Nc1cc(C(=O)OC)ccc1C(=O)OC |
| InChI | InChI=1S/C20H29NO5/c1-4-5-6-7-8-9-10-11-18(22)21-17-14-15(19(23)25-2)12-13-16(17)20(24)26-3/h12-14H,4-11H2,1-3H3,(H,21,22) |
| InChIKey | NKDBPSCVBPWTJS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|