C19H25NO5 — CID 843119
dimethyl 2-(3-cyclohexylpropanoylamino)benzene-1,4-dicarboxylate (PubChem CID 843119) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is dimethyl 2-(3-cyclohexylpropanoylamino)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(3-cyclohexylpropanoylamino)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 843119 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | dimethyl 2-(3-cyclohexylpropanoylamino)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)CCC2CCCCC2)c1 |
| InChI | InChI=1S/C19H25NO5/c1-24-18(22)14-9-10-15(19(23)25-2)16(12-14)20-17(21)11-8-13-6-4-3-5-7-13/h9-10,12-13H,3-8,11H2,1-2H3,(H,20,21) |
| InChIKey | ZNVNZZMXZQTXFC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |