C17H16N2O5 — CID 110697209
dimethyl 2-[(2-pyridin-3-ylacetyl)amino]benzene-1,4-dicarboxylate (PubChem CID 110697209) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is dimethyl 2-[(2-pyridin-3-ylacetyl)amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(2-pyridin-3-ylacetyl)amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 110697209 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | dimethyl 2-[(2-pyridin-3-ylacetyl)amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)Cc2cccnc2)c1 |
| InChI | InChI=1S/C17H16N2O5/c1-23-16(21)12-5-6-13(17(22)24-2)14(9-12)19-15(20)8-11-4-3-7-18-10-11/h3-7,9-10H,8H2,1-2H3,(H,19,20) |
| InChIKey | SCDMOIHVQDDUHU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |