C19H15F3N2O6 — CID 108501394
dimethyl 2-[[2-oxo-2-[3-(trifluoromethyl)anilino]acetyl]amino]benzene-1,4-dicarboxylate (PubChem CID 108501394) has the molecular formula C19H15F3N2O6 and a molecular weight of 424.33 g/mol. Its IUPAC name is dimethyl 2-[[2-oxo-2-[3-(trifluoromethyl)anilino]acetyl]amino]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[2-oxo-2-[3-(trifluoromethyl)anilino]acetyl]amino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 108501394 |
| Molecular Formula | C19H15F3N2O6 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | dimethyl 2-[[2-oxo-2-[3-(trifluoromethyl)anilino]acetyl]amino]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(NC(=O)C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H15F3N2O6/c1-29-17(27)10-6-7-13(18(28)30-2)14(8-10)24-16(26)15(25)23-12-5-3-4-11(9-12)19(20,21)22/h3-9H,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | XSUIMLCZPBYTQT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|