C23H22N2O2S3 — CID 4061884
methyl 4-(4-methylphenyl)sulfanyl-3-[(3-methylsulfanylphenyl)carbamothioylamino]benzoate (PubChem CID 4061884) has the molecular formula C23H22N2O2S3 and a molecular weight of 454.64 g/mol. Its IUPAC name is methyl 4-(4-methylphenyl)sulfanyl-3-[(3-methylsulfanylphenyl)carbamothioylamino]benzoate.
| Compound Name | methyl 4-(4-methylphenyl)sulfanyl-3-[(3-methylsulfanylphenyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 4061884 |
| Molecular Formula | C23H22N2O2S3 |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | methyl 4-(4-methylphenyl)sulfanyl-3-[(3-methylsulfanylphenyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccc(Sc2ccc(C)cc2)c(NC(=S)Nc2cccc(SC)c2)c1 |
| InChI | InChI=1S/C23H22N2O2S3/c1-15-7-10-18(11-8-15)30-21-12-9-16(22(26)27-2)13-20(21)25-23(28)24-17-5-4-6-19(14-17)29-3/h4-14H,1-3H3,(H2,24,25,28) |
| InChIKey | TZPCUKGXDDADEL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|