C23H35N3S2 — CID 4094626
1-[3-[butyl(methyl)amino]propyl]-1-(thiophen-2-ylmethyl)-3-(2,4,6-trimethylphenyl)thiourea (PubChem CID 4094626) has the molecular formula C23H35N3S2 and a molecular weight of 417.69 g/mol. Its IUPAC name is 1-[3-[butyl(methyl)amino]propyl]-1-(thiophen-2-ylmethyl)-3-(2,4,6-trimethylphenyl)thiourea.
| Compound Name | 1-[3-[butyl(methyl)amino]propyl]-1-(thiophen-2-ylmethyl)-3-(2,4,6-trimethylphenyl)thiourea |
|---|---|
| PubChem CID | 4094626 |
| Molecular Formula | C23H35N3S2 |
| Molecular Weight | 417.69 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 1-[3-[butyl(methyl)amino]propyl]-1-(thiophen-2-ylmethyl)-3-(2,4,6-trimethylphenyl)thiourea |
| SMILES | CCCCN(C)CCCN(Cc1cccs1)C(=S)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C23H35N3S2/c1-6-7-11-25(5)12-9-13-26(17-21-10-8-14-28-21)23(27)24-22-19(3)15-18(2)16-20(22)4/h8,10,14-16H,6-7,9,11-13,17H2,1-5H3,(H,24,27) |
| InChIKey | SWJXDRGZQXGEKH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|