C18H23N3OS2 — CID 71903136
2-[methyl(thiophen-2-ylmethylcarbamothioyl)amino]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 71903136) has the molecular formula C18H23N3OS2 and a molecular weight of 361.54 g/mol. Its IUPAC name is 2-[methyl(thiophen-2-ylmethylcarbamothioyl)amino]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[methyl(thiophen-2-ylmethylcarbamothioyl)amino]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 71903136 |
| Molecular Formula | C18H23N3OS2 |
| Molecular Weight | 361.54 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 2-[methyl(thiophen-2-ylmethylcarbamothioyl)amino]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CN(C)C(=S)NCc2cccs2)c(C)c1 |
| InChI | InChI=1S/C18H23N3OS2/c1-12-8-13(2)17(14(3)9-12)20-16(22)11-21(4)18(23)19-10-15-6-5-7-24-15/h5-9H,10-11H2,1-4H3,(H,19,23)(H,20,22) |
| InChIKey | XSGYEHYOOCHDFR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|