C12H15N3OS2 — CID 75415342
1-methyl-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)thiourea (PubChem CID 75415342) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is 1-methyl-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-methyl-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 75415342 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1-methyl-1-[(5-methyl-1,2-oxazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1cc(CN(C)C(=S)NCc2cccs2)no1 |
| InChI | InChI=1S/C12H15N3OS2/c1-9-6-10(14-16-9)8-15(2)12(17)13-7-11-4-3-5-18-11/h3-6H,7-8H2,1-2H3,(H,13,17) |
| InChIKey | YOEKMODIMLNXMW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|