C27H32N4S2 — CID 2473173
1-benzyl-3-(3,4-dimethylphenyl)-1-[2-[(3,4-dimethylphenyl)carbamothioylamino]ethyl]thiourea (PubChem CID 2473173) has the molecular formula C27H32N4S2 and a molecular weight of 476.72 g/mol. Its IUPAC name is 1-benzyl-3-(3,4-dimethylphenyl)-1-[2-[(3,4-dimethylphenyl)carbamothioylamino]ethyl]thiourea.
| Compound Name | 1-benzyl-3-(3,4-dimethylphenyl)-1-[2-[(3,4-dimethylphenyl)carbamothioylamino]ethyl]thiourea |
|---|---|
| PubChem CID | 2473173 |
| Molecular Formula | C27H32N4S2 |
| Molecular Weight | 476.72 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 1-benzyl-3-(3,4-dimethylphenyl)-1-[2-[(3,4-dimethylphenyl)carbamothioylamino]ethyl]thiourea |
| SMILES | Cc1ccc(NC(=S)NCCN(Cc2ccccc2)C(=S)Nc2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C27H32N4S2/c1-19-10-12-24(16-21(19)3)29-26(32)28-14-15-31(18-23-8-6-5-7-9-23)27(33)30-25-13-11-20(2)22(4)17-25/h5-13,16-17H,14-15,18H2,1-4H3,(H,30,33)(H2,28,29,32) |
| InChIKey | HDYMUWZIZRILAB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|