C19H20N2O3S2 — CID 8684393
1-benzyl-1-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-methoxyphenyl)thiourea (PubChem CID 8684393) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 1-benzyl-1-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-benzyl-1-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 8684393 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 1-benzyl-1-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(Cc2ccccc2)[C@H]2C=CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C19H20N2O3S2/c1-24-18-9-7-16(8-10-18)20-19(25)21(13-15-5-3-2-4-6-15)17-11-12-26(22,23)14-17/h2-12,17H,13-14H2,1H3,(H,20,25)/t17-/m0/s1 |
| InChIKey | VNIJZHSBLYCNKZ-KRWDZBQOSA-N |
| XLogP | 3.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|