C21H24N2O2S2 — CID 8684407
1-benzyl-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-propan-2-ylphenyl)thiourea (PubChem CID 8684407) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-benzyl-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-propan-2-ylphenyl)thiourea.
| Compound Name | 1-benzyl-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-propan-2-ylphenyl)thiourea |
|---|---|
| PubChem CID | 8684407 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 1-benzyl-1-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-3-(4-propan-2-ylphenyl)thiourea |
| SMILES | CC(C)c1ccc(NC(=S)N(Cc2ccccc2)[C@@H]2C=CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H24N2O2S2/c1-16(2)18-8-10-19(11-9-18)22-21(26)23(14-17-6-4-3-5-7-17)20-12-13-27(24,25)15-20/h3-13,16,20H,14-15H2,1-2H3,(H,22,26)/t20-/m1/s1 |
| InChIKey | GRHFRQRILHOCGG-HXUWFJFHSA-N |
| XLogP | 4.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|