C21H19NO6S — CID 9019711
[2-[benzyl-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]amino]-2-oxoethyl] 4-formylbenzoate (PubChem CID 9019711) has the molecular formula C21H19NO6S and a molecular weight of 413.45 g/mol. Its IUPAC name is [2-[benzyl-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]amino]-2-oxoethyl] 4-formylbenzoate.
| Compound Name | [2-[benzyl-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]amino]-2-oxoethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 9019711 |
| Molecular Formula | C21H19NO6S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | [2-[benzyl-[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]amino]-2-oxoethyl] 4-formylbenzoate |
| SMILES | O=Cc1ccc(C(=O)OCC(=O)N(Cc2ccccc2)[C@@H]2C=CS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H19NO6S/c23-13-17-6-8-18(9-7-17)21(25)28-14-20(24)22(12-16-4-2-1-3-5-16)19-10-11-29(26,27)15-19/h1-11,13,19H,12,14-15H2/t19-/m1/s1 |
| InChIKey | LJHMSFWUQXFRIL-LJQANCHMSA-N |
| XLogP | 2.00 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|