C20H20N2O6S — CID 8647895
N-benzyl-N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-(3-methyl-4-nitrophenoxy)acetamide (PubChem CID 8647895) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is N-benzyl-N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-(3-methyl-4-nitrophenoxy)acetamide.
| Compound Name | N-benzyl-N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-(3-methyl-4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 8647895 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | N-benzyl-N-[(3S)-1,1-dioxo-2,3-dihydrothiophen-3-yl]-2-(3-methyl-4-nitrophenoxy)acetamide |
| SMILES | Cc1cc(OCC(=O)N(Cc2ccccc2)[C@H]2C=CS(=O)(=O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N2O6S/c1-15-11-18(7-8-19(15)22(24)25)28-13-20(23)21(12-16-5-3-2-4-6-16)17-9-10-29(26,27)14-17/h2-11,17H,12-14H2,1H3/t17-/m0/s1 |
| InChIKey | ZNQDBJGGTZCRHQ-KRWDZBQOSA-N |
| XLogP | 2.62 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|