C18H20N2O7S — CID 9380986
N-[(3S)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)-2-(3-methyl-4-nitrophenoxy)acetamide (PubChem CID 9380986) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)-2-(3-methyl-4-nitrophenoxy)acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)-2-(3-methyl-4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 9380986 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-N-(furan-2-ylmethyl)-2-(3-methyl-4-nitrophenoxy)acetamide |
| SMILES | Cc1cc(OCC(=O)N(Cc2ccco2)[C@H]2CCS(=O)(=O)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H20N2O7S/c1-13-9-15(4-5-17(13)20(22)23)27-11-18(21)19(10-16-3-2-7-26-16)14-6-8-28(24,25)12-14/h2-5,7,9,14H,6,8,10-12H2,1H3/t14-/m0/s1 |
| InChIKey | CFTJQILEOMTIQZ-AWEZNQCLSA-N |
| XLogP | 2.09 |
| TPSA | 119.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|