C36H40N4O2S — CID 59578131
[(2S)-2-(dibenzylamino)propyl] 4-[N-(phenylcarbamothioyl)anilino]piperidine-1-carboxylate (PubChem CID 59578131) has the molecular formula C36H40N4O2S and a molecular weight of 592.81 g/mol. Its IUPAC name is [(2S)-2-(dibenzylamino)propyl] 4-[N-(phenylcarbamothioyl)anilino]piperidine-1-carboxylate.
| Compound Name | [(2S)-2-(dibenzylamino)propyl] 4-[N-(phenylcarbamothioyl)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59578131 |
| Molecular Formula | C36H40N4O2S |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | [(2S)-2-(dibenzylamino)propyl] 4-[N-(phenylcarbamothioyl)anilino]piperidine-1-carboxylate |
| SMILES | C[C@@H](COC(=O)N1CCC(N(C(=S)Nc2ccccc2)c2ccccc2)CC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C36H40N4O2S/c1-29(39(26-30-14-6-2-7-15-30)27-31-16-8-3-9-17-31)28-42-36(41)38-24-22-34(23-25-38)40(33-20-12-5-13-21-33)35(43)37-32-18-10-4-11-19-32/h2-21,29,34H,22-28H2,1H3,(H,37,43)/t29-/m0/s1 |
| InChIKey | KQQPTYWUHPYZLU-LJAQVGFWSA-N |
| XLogP | 7.58 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|