C24H32N2O3S — CID 160559419
[(2S)-2-(dibenzylamino)propyl] 4-oxoazepane-1-carboxylate;sulfane (PubChem CID 160559419) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is [(2S)-2-(dibenzylamino)propyl] 4-oxoazepane-1-carboxylate;sulfane.
| Compound Name | [(2S)-2-(dibenzylamino)propyl] 4-oxoazepane-1-carboxylate;sulfane |
|---|---|
| PubChem CID | 160559419 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | [(2S)-2-(dibenzylamino)propyl] 4-oxoazepane-1-carboxylate;sulfane |
| SMILES | C[C@@H](COC(=O)N1CCCC(=O)CC1)N(Cc1ccccc1)Cc1ccccc1.S |
| InChI | InChI=1S/C24H30N2O3.H2S/c1-20(19-29-24(28)25-15-8-13-23(27)14-16-25)26(17-21-9-4-2-5-10-21)18-22-11-6-3-7-12-22;/h2-7,9-12,20H,8,13-19H2,1H3;1H2/t20-;/m0./s1 |
| InChIKey | QZCMJXKRNHJMIZ-BDQAORGHSA-N |
| XLogP | 4.38 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |