C34H39N3O5 — CID 69141460
2-[1-[2-(dibenzylamino)propoxycarbonyl]piperidin-4-yl]oxy-3-ethylindole-1-carboxylic acid (PubChem CID 69141460) has the molecular formula C34H39N3O5 and a molecular weight of 569.70 g/mol. Its IUPAC name is 2-[1-[2-(dibenzylamino)propoxycarbonyl]piperidin-4-yl]oxy-3-ethylindole-1-carboxylic acid.
| Compound Name | 2-[1-[2-(dibenzylamino)propoxycarbonyl]piperidin-4-yl]oxy-3-ethylindole-1-carboxylic acid |
|---|---|
| PubChem CID | 69141460 |
| Molecular Formula | C34H39N3O5 |
| Molecular Weight | 569.70 g/mol |
| Exact Mass | 569.29 |
| IUPAC Name | 2-[1-[2-(dibenzylamino)propoxycarbonyl]piperidin-4-yl]oxy-3-ethylindole-1-carboxylic acid |
| SMILES | CCc1c(OC2CCN(C(=O)OCC(C)N(Cc3ccccc3)Cc3ccccc3)CC2)n(C(=O)O)c2ccccc12 |
| InChI | InChI=1S/C34H39N3O5/c1-3-29-30-16-10-11-17-31(30)37(33(38)39)32(29)42-28-18-20-35(21-19-28)34(40)41-24-25(2)36(22-26-12-6-4-7-13-26)23-27-14-8-5-9-15-27/h4-17,25,28H,3,18-24H2,1-2H3,(H,38,39) |
| InChIKey | BYSBFDKYRCYLFG-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |