C32H40N4O3 — CID 68773282
2-(dibenzylamino)propyl 4-[N-(ethylcarbamoyl)anilino]piperidine-1-carboxylate (PubChem CID 68773282) has the molecular formula C32H40N4O3 and a molecular weight of 528.70 g/mol. Its IUPAC name is 2-(dibenzylamino)propyl 4-[N-(ethylcarbamoyl)anilino]piperidine-1-carboxylate.
| Compound Name | 2-(dibenzylamino)propyl 4-[N-(ethylcarbamoyl)anilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68773282 |
| Molecular Formula | C32H40N4O3 |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | 2-(dibenzylamino)propyl 4-[N-(ethylcarbamoyl)anilino]piperidine-1-carboxylate |
| SMILES | CCNC(=O)N(c1ccccc1)C1CCN(C(=O)OCC(C)N(Cc2ccccc2)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H40N4O3/c1-3-33-31(37)36(29-17-11-6-12-18-29)30-19-21-34(22-20-30)32(38)39-25-26(2)35(23-27-13-7-4-8-14-27)24-28-15-9-5-10-16-28/h4-18,26,30H,3,19-25H2,1-2H3,(H,33,37) |
| InChIKey | PUMNJCJXWUJJEO-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |