C24H30N2O3 — CID 67178545
2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate (PubChem CID 67178545) has the molecular formula C24H30N2O3 and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate.
| Compound Name | 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate |
|---|---|
| PubChem CID | 67178545 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate |
| SMILES | CC(COC(=O)N1CCCC(=O)CC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H30N2O3/c1-20(19-29-24(28)25-15-8-13-23(27)14-16-25)26(17-21-9-4-2-5-10-21)18-22-11-6-3-7-12-22/h2-7,9-12,20H,8,13-19H2,1H3 |
| InChIKey | SOXKRDXYLPJUQF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |