2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate

C24H30N2O3 — CID 67178545

IUPAC2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate
SMILESCC(COC(=O)N1CCCC(=O)CC1)N(Cc1ccccc1)Cc1ccccc1
InChIInChI=1S/C24H30N2O3/c1-20(19-29-24(28)25-15-8-13-23(27)14-16-25)26(17-21-9-4-2-5-10-21)18-22-11-6-3-7-12-22/h2-7,9-12,20H,8,13-19H2,1H3
InChIKeySOXKRDXYLPJUQF-UHFFFAOYSA-N
MW394.51 g/mol
LogP4.27
Rot. Bonds7

About 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate

2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate (PubChem CID 67178545) has the molecular formula C24H30N2O3 and a molecular weight of 394.51 g/mol. Its IUPAC name is 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate.

Molecular Properties

Compound Name2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate
PubChem CID67178545
Molecular FormulaC24H30N2O3
Molecular Weight394.51 g/mol
Exact Mass394.23
IUPAC Name2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate
SMILESCC(COC(=O)N1CCCC(=O)CC1)N(Cc1ccccc1)Cc1ccccc1
InChIInChI=1S/C24H30N2O3/c1-20(19-29-24(28)25-15-8-13-23(27)14-16-25)26(17-21-9-4-2-5-10-21)18-22-11-6-3-7-12-22/h2-7,9-12,20H,8,13-19H2,1H3
InChIKeySOXKRDXYLPJUQF-UHFFFAOYSA-N
XLogP4.27
TPSA49.85 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms29
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500394.51
LogP ≤ 54.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate?
The IUPAC name of 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate (CID 67178545) is 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate.
What is the SMILES notation for 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate?
The canonical SMILES for 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate is CC(COC(=O)N1CCCC(=O)CC1)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate?
The InChIKey is SOXKRDXYLPJUQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O3/c1-20(19-29-24(28)25-15-8-13-23(27)14-16-25)26(17-21-9-4-2-5-10-21)18-22-11-6-3-7-12-22/h2-7,9-12,20H,8,13-19H2,1H3.
What are the key properties of 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate?
2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate has a molecular weight of 394.51 g/mol, XLogP of 4.27, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibenzylamino)propyl 4-oxoazepane-1-carboxylate is sourced from PubChem (CID 67178545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).