C16H22BrN3O4 — CID 175907285
tert-butyl 3-(5-bromo-2-nitroanilino)piperidine-1-carboxylate (PubChem CID 175907285) has the molecular formula C16H22BrN3O4 and a molecular weight of 400.27 g/mol. Its IUPAC name is tert-butyl 3-(5-bromo-2-nitroanilino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(5-bromo-2-nitroanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175907285 |
| Molecular Formula | C16H22BrN3O4 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | tert-butyl 3-(5-bromo-2-nitroanilino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Nc2cc(Br)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H22BrN3O4/c1-16(2,3)24-15(21)19-8-4-5-12(10-19)18-13-9-11(17)6-7-14(13)20(22)23/h6-7,9,12,18H,4-5,8,10H2,1-3H3 |
| InChIKey | CQJMXSUHZFBNDN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|