C17H24N4O6 — CID 126616999
ethyl 4-[5-[methoxy(methyl)carbamoyl]-2-nitroanilino]piperidine-1-carboxylate (PubChem CID 126616999) has the molecular formula C17H24N4O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is ethyl 4-[5-[methoxy(methyl)carbamoyl]-2-nitroanilino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[5-[methoxy(methyl)carbamoyl]-2-nitroanilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 126616999 |
| Molecular Formula | C17H24N4O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | ethyl 4-[5-[methoxy(methyl)carbamoyl]-2-nitroanilino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2cc(C(=O)N(C)OC)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H24N4O6/c1-4-27-17(23)20-9-7-13(8-10-20)18-14-11-12(16(22)19(2)26-3)5-6-15(14)21(24)25/h5-6,11,13,18H,4,7-10H2,1-3H3 |
| InChIKey | HKAHXPJIJUVZCB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|