C13H18N4O4 — CID 23374509
ethyl 4-[(3-nitro-4-pyridinyl)amino]piperidine-1-carboxylate (PubChem CID 23374509) has the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is ethyl 4-[(3-nitro-4-pyridinyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(3-nitro-4-pyridinyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23374509 |
| Molecular Formula | C13H18N4O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | ethyl 4-[(3-nitro-4-pyridinyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H18N4O4/c1-2-21-13(18)16-7-4-10(5-8-16)15-11-3-6-14-9-12(11)17(19)20/h3,6,9-10H,2,4-5,7-8H2,1H3,(H,14,15) |
| InChIKey | IDZHJCGQMQRDBD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|