C18H30N4O3 — CID 163381732
tert-butyl 4-[(3-amino-6-propan-2-yloxy-2-pyridinyl)amino]piperidine-1-carboxylate (PubChem CID 163381732) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl 4-[(3-amino-6-propan-2-yloxy-2-pyridinyl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-amino-6-propan-2-yloxy-2-pyridinyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 163381732 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | tert-butyl 4-[(3-amino-6-propan-2-yloxy-2-pyridinyl)amino]piperidine-1-carboxylate |
| SMILES | CC(C)Oc1ccc(N)c(NC2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C18H30N4O3/c1-12(2)24-15-7-6-14(19)16(21-15)20-13-8-10-22(11-9-13)17(23)25-18(3,4)5/h6-7,12-13H,8-11,19H2,1-5H3,(H,20,21) |
| InChIKey | SSAHLZSMWWDTRA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |