C14H22N4O2 — CID 67198211
tert-butyl 4-(pyrimidin-5-ylamino)piperidine-1-carboxylate (PubChem CID 67198211) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is tert-butyl 4-(pyrimidin-5-ylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(pyrimidin-5-ylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67198211 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | tert-butyl 4-(pyrimidin-5-ylamino)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cncnc2)CC1 |
| InChI | InChI=1S/C14H22N4O2/c1-14(2,3)20-13(19)18-6-4-11(5-7-18)17-12-8-15-10-16-9-12/h8-11,17H,4-7H2,1-3H3 |
| InChIKey | STENFLRCSQYJKS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |