C22H31N3O6 — CID 168568701
dimethyl (E)-2-[4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]anilino]but-2-enedioate (PubChem CID 168568701) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is dimethyl (E)-2-[4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568701 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | dimethyl (E)-2-[4-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]amino]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(NC2CCN(C(=O)OC(C)(C)C)CC2)cc1)C(=O)OC |
| InChI | InChI=1S/C22H31N3O6/c1-22(2,3)31-21(28)25-12-10-17(11-13-25)23-15-6-8-16(9-7-15)24-18(20(27)30-5)14-19(26)29-4/h6-9,14,17,23-24H,10-13H2,1-5H3/b18-14+ |
| InChIKey | IQPPWYUWLXKDLG-NBVRZTHBSA-N |
| XLogP | 3.14 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|