C22H31N3O8S — CID 168568765
dimethyl (E)-2-[2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]sulfamoyl]anilino]but-2-enedioate (PubChem CID 168568765) has the molecular formula C22H31N3O8S and a molecular weight of 497.57 g/mol. Its IUPAC name is dimethyl (E)-2-[2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]sulfamoyl]anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]sulfamoyl]anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568765 |
| Molecular Formula | C22H31N3O8S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | dimethyl (E)-2-[2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]sulfamoyl]anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccccc1S(=O)(=O)NC1CCN(C(=O)OC(C)(C)C)CC1)C(=O)OC |
| InChI | InChI=1S/C22H31N3O8S/c1-22(2,3)33-21(28)25-12-10-15(11-13-25)24-34(29,30)18-9-7-6-8-16(18)23-17(20(27)32-5)14-19(26)31-4/h6-9,14-15,23-24H,10-13H2,1-5H3/b17-14+ |
| InChIKey | RBKMWKITIUJKBN-SAPNQHFASA-N |
| XLogP | 2.01 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|