C20H26N8O4S — CID 169345004
tert-butyl 4-[[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 169345004) has the molecular formula C20H26N8O4S and a molecular weight of 474.55 g/mol. Its IUPAC name is tert-butyl 4-[[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169345004 |
| Molecular Formula | C20H26N8O4S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | tert-butyl 4-[[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NS(=O)(=O)c2ccccc2NC=C(C#N)c2nn[nH]n2)CC1 |
| InChI | InChI=1S/C20H26N8O4S/c1-20(2,3)32-19(29)28-10-8-15(9-11-28)25-33(30,31)17-7-5-4-6-16(17)22-13-14(12-21)18-23-26-27-24-18/h4-7,13,15,22,25H,8-11H2,1-3H3,(H,23,24,26,27) |
| InChIKey | XGMQKJPNMYVMIT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 165.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|