C20H25FN8O2 — CID 169343055
tert-butyl 4-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-6-fluoroanilino]piperidine-1-carboxylate (PubChem CID 169343055) has the molecular formula C20H25FN8O2 and a molecular weight of 428.47 g/mol. Its IUPAC name is tert-butyl 4-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-6-fluoroanilino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-6-fluoroanilino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169343055 |
| Molecular Formula | C20H25FN8O2 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | tert-butyl 4-[2-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-6-fluoroanilino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2c(F)cccc2NC=C(C#N)c2nn[nH]n2)CC1 |
| InChI | InChI=1S/C20H25FN8O2/c1-20(2,3)31-19(30)29-9-7-14(8-10-29)24-17-15(21)5-4-6-16(17)23-12-13(11-22)18-25-27-28-26-18/h4-6,12,14,23-24H,7-10H2,1-3H3,(H,25,26,27,28) |
| InChIKey | UOTPPENFLPRJMU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 131.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|