C18H26FN3O3 — CID 168652361
tert-butyl 4-[(3-fluoro-2-formamidoanilino)methyl]piperidine-1-carboxylate (PubChem CID 168652361) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is tert-butyl 4-[(3-fluoro-2-formamidoanilino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-fluoro-2-formamidoanilino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168652361 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | tert-butyl 4-[(3-fluoro-2-formamidoanilino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CNc2cccc(F)c2NC=O)CC1 |
| InChI | InChI=1S/C18H26FN3O3/c1-18(2,3)25-17(24)22-9-7-13(8-10-22)11-20-15-6-4-5-14(19)16(15)21-12-23/h4-6,12-13,20H,7-11H2,1-3H3,(H,21,23) |
| InChIKey | LULNNJGRSLMJLM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|