C20H28FN5O2S — CID 169363566
tert-butyl 4-[[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-fluoroanilino]methyl]piperidine-1-carboxylate (PubChem CID 169363566) has the molecular formula C20H28FN5O2S and a molecular weight of 421.54 g/mol. Its IUPAC name is tert-butyl 4-[[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-fluoroanilino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-fluoroanilino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169363566 |
| Molecular Formula | C20H28FN5O2S |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | tert-butyl 4-[[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-fluoroanilino]methyl]piperidine-1-carboxylate |
| SMILES | CS/C(=N\c1c(F)cccc1NCC1CCN(C(=O)OC(C)(C)C)CC1)NC#N |
| InChI | InChI=1S/C20H28FN5O2S/c1-20(2,3)28-19(27)26-10-8-14(9-11-26)12-23-16-7-5-6-15(21)17(16)25-18(29-4)24-13-22/h5-7,14,23H,8-12H2,1-4H3,(H,24,25) |
| InChIKey | YHKSHFADUBBKRB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|