C19H25FN4O3S — CID 169363558
tert-butyl 4-[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-fluorophenoxy]piperidine-1-carboxylate (PubChem CID 169363558) has the molecular formula C19H25FN4O3S and a molecular weight of 408.50 g/mol. Its IUPAC name is tert-butyl 4-[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-fluorophenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-fluorophenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169363558 |
| Molecular Formula | C19H25FN4O3S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | tert-butyl 4-[2-[[(cyanoamino)-methylsulfanylmethylidene]amino]-3-fluorophenoxy]piperidine-1-carboxylate |
| SMILES | CS/C(=N\c1c(F)cccc1OC1CCN(C(=O)OC(C)(C)C)CC1)NC#N |
| InChI | InChI=1S/C19H25FN4O3S/c1-19(2,3)27-18(25)24-10-8-13(9-11-24)26-15-7-5-6-14(20)16(15)23-17(28-4)22-12-21/h5-7,13H,8-11H2,1-4H3,(H,22,23) |
| InChIKey | LQVOBDMZDZIOCM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|