C20H28N4O3S — CID 169361349
tert-butyl 4-[4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-methylphenoxy]piperidine-1-carboxylate (PubChem CID 169361349) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is tert-butyl 4-[4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-methylphenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-methylphenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169361349 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | tert-butyl 4-[4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-2-methylphenoxy]piperidine-1-carboxylate |
| SMILES | CS/C(=N\c1ccc(OC2CCN(C(=O)OC(C)(C)C)CC2)c(C)c1)NC#N |
| InChI | InChI=1S/C20H28N4O3S/c1-14-12-15(23-18(28-5)22-13-21)6-7-17(14)26-16-8-10-24(11-9-16)19(25)27-20(2,3)4/h6-7,12,16H,8-11H2,1-5H3,(H,22,23) |
| InChIKey | CAHBLLLDXWMFLG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|