C26H28ClF3N4O4S2 — CID 118632531
tert-butyl 4-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidine-1-carboxylate (PubChem CID 118632531) has the molecular formula C26H28ClF3N4O4S2 and a molecular weight of 617.12 g/mol. Its IUPAC name is tert-butyl 4-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118632531 |
| Molecular Formula | C26H28ClF3N4O4S2 |
| Molecular Weight | 617.12 g/mol |
| Exact Mass | 616.12 |
| IUPAC Name | tert-butyl 4-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethylidene]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylpiperidine-1-carboxylate |
| SMILES | CS/C(=N\c1cc(Cl)c(-c2ccc(S(=O)(=O)C3CCN(C(=O)OC(C)(C)C)CC3)cc2)c(C(F)(F)F)c1)NC#N |
| InChI | InChI=1S/C26H28ClF3N4O4S2/c1-25(2,3)38-24(35)34-11-9-19(10-12-34)40(36,37)18-7-5-16(6-8-18)22-20(26(28,29)30)13-17(14-21(22)27)33-23(39-4)32-15-31/h5-8,13-14,19H,9-12H2,1-4H3,(H,32,33) |
| InChIKey | DJDDAMMBHVDOKO-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.12 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|