C27H32ClF3N4O4S2 — CID 118625259
tert-butyl 4-[[4-[2-chloro-4-[(cyanoamino)-(methylsulfanylmethyl)amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]piperidine-1-carboxylate (PubChem CID 118625259) has the molecular formula C27H32ClF3N4O4S2 and a molecular weight of 633.16 g/mol. Its IUPAC name is tert-butyl 4-[[4-[2-chloro-4-[(cyanoamino)-(methylsulfanylmethyl)amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[2-chloro-4-[(cyanoamino)-(methylsulfanylmethyl)amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118625259 |
| Molecular Formula | C27H32ClF3N4O4S2 |
| Molecular Weight | 633.16 g/mol |
| Exact Mass | 632.15 |
| IUPAC Name | tert-butyl 4-[[4-[2-chloro-4-[(cyanoamino)-(methylsulfanylmethyl)amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]piperidine-1-carboxylate |
| SMILES | CSCN(NC#N)c1cc(Cl)c(-c2ccc(S(=O)(=O)CC3CCN(C(=O)OC(C)(C)C)CC3)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H32ClF3N4O4S2/c1-26(2,3)39-25(36)34-11-9-18(10-12-34)15-41(37,38)21-7-5-19(6-8-21)24-22(27(29,30)31)13-20(14-23(24)28)35(17-40-4)33-16-32/h5-8,13-14,18,33H,9-12,15,17H2,1-4H3 |
| InChIKey | YLVUWLUMXPAAJF-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.16 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|