C26H30ClF3N4O4S2 — CID 118624836
tert-butyl 2-[[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethyl]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]pyrrolidine-1-carboxylate (PubChem CID 118624836) has the molecular formula C26H30ClF3N4O4S2 and a molecular weight of 619.13 g/mol. Its IUPAC name is tert-butyl 2-[[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethyl]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethyl]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118624836 |
| Molecular Formula | C26H30ClF3N4O4S2 |
| Molecular Weight | 619.13 g/mol |
| Exact Mass | 618.13 |
| IUPAC Name | tert-butyl 2-[[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethyl]amino]-6-(trifluoromethyl)phenyl]phenyl]sulfonylmethyl]pyrrolidine-1-carboxylate |
| SMILES | CSC(NC#N)Nc1cc(Cl)c(-c2ccc(S(=O)(=O)CC3CCCN3C(=O)OC(C)(C)C)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H30ClF3N4O4S2/c1-25(2,3)38-24(35)34-11-5-6-18(34)14-40(36,37)19-9-7-16(8-10-19)22-20(26(28,29)30)12-17(13-21(22)27)33-23(39-4)32-15-31/h7-10,12-13,18,23,32-33H,5-6,11,14H2,1-4H3 |
| InChIKey | IJLLOQZOXDWGCE-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.13 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|