C19H20ClF3N4O2S2 — CID 118625206
N-[2-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethyl]amino]-6-(trifluoromethyl)phenyl]phenyl]ethyl]methanesulfonamide (PubChem CID 118625206) has the molecular formula C19H20ClF3N4O2S2 and a molecular weight of 492.98 g/mol. Its IUPAC name is N-[2-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethyl]amino]-6-(trifluoromethyl)phenyl]phenyl]ethyl]methanesulfonamide.
| Compound Name | N-[2-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethyl]amino]-6-(trifluoromethyl)phenyl]phenyl]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 118625206 |
| Molecular Formula | C19H20ClF3N4O2S2 |
| Molecular Weight | 492.98 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | N-[2-[4-[2-chloro-4-[[(cyanoamino)-methylsulfanylmethyl]amino]-6-(trifluoromethyl)phenyl]phenyl]ethyl]methanesulfonamide |
| SMILES | CSC(NC#N)Nc1cc(Cl)c(-c2ccc(CCNS(C)(=O)=O)cc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20ClF3N4O2S2/c1-30-18(25-11-24)27-14-9-15(19(21,22)23)17(16(20)10-14)13-5-3-12(4-6-13)7-8-26-31(2,28)29/h3-6,9-10,18,25-27H,7-8H2,1-2H3 |
| InChIKey | ZVMBKCRWYLARPD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.98 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|