About 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane
4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane (PubChem CID 143040290) has the molecular formula C18H23N3O4S
and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane.
Molecular Properties
| Compound Name | 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane |
| PubChem CID | 143040290 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane |
| SMILES | CC.Cn1cc(C#N)c(-c2ccc(CCNS(C)(=O)=O)cc2)c1C(=O)O |
| InChI | InChI=1S/C16H17N3O4S.C2H6/c1-19-10-13(9-17)14(15(19)16(20)21)12-5-3-11(4-6-12)7-8-18-24(2,22)23;1-2/h3-6,10,18H,7-8H2,1-2H3,(H,20,21);1-2H3 |
| InChIKey | SQQJZGYRQCHVBP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane?
The IUPAC name of 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane (CID 143040290) is 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane.
What is the SMILES notation for 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane?
The canonical SMILES for 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane is CC.Cn1cc(C#N)c(-c2ccc(CCNS(C)(=O)=O)cc2)c1C(=O)O.
What is the InChIKey of 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane?
The InChIKey is SQQJZGYRQCHVBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O4S.C2H6/c1-19-10-13(9-17)14(15(19)16(20)21)12-5-3-11(4-6-12)7-8-18-24(2,22)23;1-2/h3-6,10,18H,7-8H2,1-2H3,(H,20,21);1-2H3.
What are the key properties of 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane?
4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane has a molecular weight of 377.47 g/mol, XLogP of 2.38, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-3-[4-[2-(methanesulfonamido)ethyl]phenyl]-1-methylpyrrole-2-carboxylic acid;ethane is sourced from PubChem (CID 143040290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).