About 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane
4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane (PubChem CID 143040445) has the molecular formula C21H18F2N2O2
and a molecular weight of 368.38 g/mol. Its IUPAC name is 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane.
Molecular Properties
| Compound Name | 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane |
| PubChem CID | 143040445 |
| Molecular Formula | C21H18F2N2O2 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane |
| SMILES | CC.Cn1cc(C#N)c(-c2ccc(-c3cc(F)ccc3F)cc2)c1C(=O)O |
| InChI | InChI=1S/C19H12F2N2O2.C2H6/c1-23-10-13(9-22)17(18(23)19(24)25)12-4-2-11(3-5-12)15-8-14(20)6-7-16(15)21;1-2/h2-8,10H,1H3,(H,24,25);1-2H3 |
| InChIKey | CVDCSNRNMCZLCK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane?
The IUPAC name of 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane (CID 143040445) is 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane.
What is the SMILES notation for 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane?
The canonical SMILES for 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane is CC.Cn1cc(C#N)c(-c2ccc(-c3cc(F)ccc3F)cc2)c1C(=O)O.
What is the InChIKey of 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane?
The InChIKey is CVDCSNRNMCZLCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F2N2O2.C2H6/c1-23-10-13(9-22)17(18(23)19(24)25)12-4-2-11(3-5-12)15-8-14(20)6-7-16(15)21;1-2/h2-8,10H,1H3,(H,24,25);1-2H3.
What are the key properties of 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane?
4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane has a molecular weight of 368.38 g/mol, XLogP of 5.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-3-[4-(2,5-difluorophenyl)phenyl]-1-methylpyrrole-2-carboxylic acid;ethane is sourced from PubChem (CID 143040445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).