C21H20N2O2 — CID 143040667
4-cyano-1-methyl-3-(4-phenylphenyl)pyrrole-2-carboxylic acid;ethane (PubChem CID 143040667) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-cyano-1-methyl-3-(4-phenylphenyl)pyrrole-2-carboxylic acid;ethane.
| Compound Name | 4-cyano-1-methyl-3-(4-phenylphenyl)pyrrole-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 143040667 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 4-cyano-1-methyl-3-(4-phenylphenyl)pyrrole-2-carboxylic acid;ethane |
| SMILES | CC.Cn1cc(C#N)c(-c2ccc(-c3ccccc3)cc2)c1C(=O)O |
| InChI | InChI=1S/C19H14N2O2.C2H6/c1-21-12-16(11-20)17(18(21)19(22)23)15-9-7-14(8-10-15)13-5-3-2-4-6-13;1-2/h2-10,12H,1H3,(H,22,23);1-2H3 |
| InChIKey | VEMBQRYDVDDQFR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |