C19H24N2O2 — CID 143040541
ethyl 4-cyano-1-methyl-3-(4-methylphenyl)pyrrole-2-carboxylate;propane (PubChem CID 143040541) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl 4-cyano-1-methyl-3-(4-methylphenyl)pyrrole-2-carboxylate;propane.
| Compound Name | ethyl 4-cyano-1-methyl-3-(4-methylphenyl)pyrrole-2-carboxylate;propane |
|---|---|
| PubChem CID | 143040541 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | ethyl 4-cyano-1-methyl-3-(4-methylphenyl)pyrrole-2-carboxylate;propane |
| SMILES | CCC.CCOC(=O)c1c(-c2ccc(C)cc2)c(C#N)cn1C |
| InChI | InChI=1S/C16H16N2O2.C3H8/c1-4-20-16(19)15-14(13(9-17)10-18(15)3)12-7-5-11(2)6-8-12;1-3-2/h5-8,10H,4H2,1-3H3;3H2,1-2H3 |
| InChIKey | FOIRVINLAMOZTG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |