C23H19N3O2 — CID 69020213
ethyl 4-cyano-3-[4-(1H-indol-7-yl)phenyl]-1-methylpyrrole-2-carboxylate (PubChem CID 69020213) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is ethyl 4-cyano-3-[4-(1H-indol-7-yl)phenyl]-1-methylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-cyano-3-[4-(1H-indol-7-yl)phenyl]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 69020213 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | ethyl 4-cyano-3-[4-(1H-indol-7-yl)phenyl]-1-methylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(-c3cccc4cc[nH]c34)cc2)c(C#N)cn1C |
| InChI | InChI=1S/C23H19N3O2/c1-3-28-23(27)22-20(18(13-24)14-26(22)2)16-9-7-15(8-10-16)19-6-4-5-17-11-12-25-21(17)19/h4-12,14,25H,3H2,1-2H3 |
| InChIKey | JOJXDDFBZJJYEC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |