C23H19N3O2 — CID 70950123
ethyl 4-cyano-3-[4-[2-(cyanomethyl)phenyl]phenyl]-1-methylpyrrole-2-carboxylate (PubChem CID 70950123) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is ethyl 4-cyano-3-[4-[2-(cyanomethyl)phenyl]phenyl]-1-methylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-cyano-3-[4-[2-(cyanomethyl)phenyl]phenyl]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 70950123 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | ethyl 4-cyano-3-[4-[2-(cyanomethyl)phenyl]phenyl]-1-methylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(-c3ccccc3CC#N)cc2)c(C#N)cn1C |
| InChI | InChI=1S/C23H19N3O2/c1-3-28-23(27)22-21(19(14-25)15-26(22)2)18-10-8-17(9-11-18)20-7-5-4-6-16(20)12-13-24/h4-11,15H,3,12H2,1-2H3 |
| InChIKey | SXOONQGZOAURPK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 78.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |