C21H18N2O3 — CID 69020185
ethyl 4-cyano-1-methyl-3-(4-phenoxyphenyl)pyrrole-2-carboxylate (PubChem CID 69020185) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is ethyl 4-cyano-1-methyl-3-(4-phenoxyphenyl)pyrrole-2-carboxylate.
| Compound Name | ethyl 4-cyano-1-methyl-3-(4-phenoxyphenyl)pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 69020185 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | ethyl 4-cyano-1-methyl-3-(4-phenoxyphenyl)pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Oc3ccccc3)cc2)c(C#N)cn1C |
| InChI | InChI=1S/C21H18N2O3/c1-3-25-21(24)20-19(16(13-22)14-23(20)2)15-9-11-18(12-10-15)26-17-7-5-4-6-8-17/h4-12,14H,3H2,1-2H3 |
| InChIKey | ZELXWCRMDDOPMI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |