C23H22N2O3 — CID 70334684
ethyl 4-cyano-3-[4-(2-ethoxyphenyl)phenyl]-1-methylpyrrole-2-carboxylate (PubChem CID 70334684) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is ethyl 4-cyano-3-[4-(2-ethoxyphenyl)phenyl]-1-methylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-cyano-3-[4-(2-ethoxyphenyl)phenyl]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 70334684 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | ethyl 4-cyano-3-[4-(2-ethoxyphenyl)phenyl]-1-methylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(-c3ccccc3OCC)cc2)c(C#N)cn1C |
| InChI | InChI=1S/C23H22N2O3/c1-4-27-20-9-7-6-8-19(20)16-10-12-17(13-11-16)21-18(14-24)15-25(3)22(21)23(26)28-5-2/h6-13,15H,4-5H2,1-3H3 |
| InChIKey | SDFDRAQXHXUFCG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |