C18H16N2O2S2 — CID 143040555
4-cyano-1-methyl-3-(4-thiophen-2-ylphenyl)pyrrole-2-carboxylic acid;methanethiol (PubChem CID 143040555) has the molecular formula C18H16N2O2S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-cyano-1-methyl-3-(4-thiophen-2-ylphenyl)pyrrole-2-carboxylic acid;methanethiol.
| Compound Name | 4-cyano-1-methyl-3-(4-thiophen-2-ylphenyl)pyrrole-2-carboxylic acid;methanethiol |
|---|---|
| PubChem CID | 143040555 |
| Molecular Formula | C18H16N2O2S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4-cyano-1-methyl-3-(4-thiophen-2-ylphenyl)pyrrole-2-carboxylic acid;methanethiol |
| SMILES | CS.Cn1cc(C#N)c(-c2ccc(-c3cccs3)cc2)c1C(=O)O |
| InChI | InChI=1S/C17H12N2O2S.CH4S/c1-19-10-13(9-18)15(16(19)17(20)21)12-6-4-11(5-7-12)14-3-2-8-22-14;1-2/h2-8,10H,1H3,(H,20,21);2H,1H3 |
| InChIKey | ZRSJNUJPKCWBKV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|