C20H18ClF3N4O2S2 — CID 118625223
methyl N'-[3-chloro-4-[4-[(1-methylcyclopropyl)sulfamoyl]phenyl]-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate (PubChem CID 118625223) has the molecular formula C20H18ClF3N4O2S2 and a molecular weight of 502.97 g/mol. Its IUPAC name is methyl N'-[3-chloro-4-[4-[(1-methylcyclopropyl)sulfamoyl]phenyl]-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate.
| Compound Name | methyl N'-[3-chloro-4-[4-[(1-methylcyclopropyl)sulfamoyl]phenyl]-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate |
|---|---|
| PubChem CID | 118625223 |
| Molecular Formula | C20H18ClF3N4O2S2 |
| Molecular Weight | 502.97 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | methyl N'-[3-chloro-4-[4-[(1-methylcyclopropyl)sulfamoyl]phenyl]-5-(trifluoromethyl)phenyl]-N-cyanocarbamimidothioate |
| SMILES | CS/C(=N\c1cc(Cl)c(-c2ccc(S(=O)(=O)NC3(C)CC3)cc2)c(C(F)(F)F)c1)NC#N |
| InChI | InChI=1S/C20H18ClF3N4O2S2/c1-19(7-8-19)28-32(29,30)14-5-3-12(4-6-14)17-15(20(22,23)24)9-13(10-16(17)21)27-18(31-2)26-11-25/h3-6,9-10,28H,7-8H2,1-2H3,(H,26,27) |
| InChIKey | WFGQZVJXGODREX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.97 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|